C19H16BrF3N2O3 — CID 166365818
1-N-[(2S)-2-(3-bromo-4-fluorophenyl)-2-hydroxyethyl]-1-N'-(2,6-difluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 166365818) has the molecular formula C19H16BrF3N2O3 and a molecular weight of 457.25 g/mol. Its IUPAC name is 1-N-[(2S)-2-(3-bromo-4-fluorophenyl)-2-hydroxyethyl]-1-N'-(2,6-difluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-[(2S)-2-(3-bromo-4-fluorophenyl)-2-hydroxyethyl]-1-N'-(2,6-difluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 166365818 |
| Molecular Formula | C19H16BrF3N2O3 |
| Molecular Weight | 457.25 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | 1-N-[(2S)-2-(3-bromo-4-fluorophenyl)-2-hydroxyethyl]-1-N'-(2,6-difluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(NC[C@@H](O)c1ccc(F)c(Br)c1)C1(C(=O)Nc2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C19H16BrF3N2O3/c20-11-8-10(4-5-12(11)21)15(26)9-24-17(27)19(6-7-19)18(28)25-16-13(22)2-1-3-14(16)23/h1-5,8,15,26H,6-7,9H2,(H,24,27)(H,25,28)/t15-/m1/s1 |
| InChIKey | HSHUUJFQKGUMNG-OAHLLOKOSA-N |
| XLogP | 3.43 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|