C13H15N5O3 — CID 166366138
(6-methyl-4-oxo-1H-pyridazin-3-yl)methyl 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate (PubChem CID 166366138) has the molecular formula C13H15N5O3 and a molecular weight of 289.30 g/mol. Its IUPAC name is (6-methyl-4-oxo-1H-pyridazin-3-yl)methyl 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate.
| Compound Name | (6-methyl-4-oxo-1H-pyridazin-3-yl)methyl 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 166366138 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | (6-methyl-4-oxo-1H-pyridazin-3-yl)methyl 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate |
| SMILES | Cc1cc(=O)c(COC(=O)C2CCCc3ncnn32)n[nH]1 |
| InChI | InChI=1S/C13H15N5O3/c1-8-5-11(19)9(17-16-8)6-21-13(20)10-3-2-4-12-14-7-15-18(10)12/h5,7,10H,2-4,6H2,1H3,(H,16,19) |
| InChIKey | QEJSUDZNZRLYHI-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |