About (5-methyl-1,3-benzothiazol-2-yl)methyl 3-(furan-2-yl)-1H-pyrazole-5-carboxylate
(5-methyl-1,3-benzothiazol-2-yl)methyl 3-(furan-2-yl)-1H-pyrazole-5-carboxylate (PubChem CID 166366546) has the molecular formula C17H13N3O3S
and a molecular weight of 339.38 g/mol. Its IUPAC name is (5-methyl-1,3-benzothiazol-2-yl)methyl 3-(furan-2-yl)-1H-pyrazole-5-carboxylate.
Molecular Properties
| Compound Name | (5-methyl-1,3-benzothiazol-2-yl)methyl 3-(furan-2-yl)-1H-pyrazole-5-carboxylate |
| PubChem CID | 166366546 |
| Molecular Formula | C17H13N3O3S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | (5-methyl-1,3-benzothiazol-2-yl)methyl 3-(furan-2-yl)-1H-pyrazole-5-carboxylate |
| SMILES | Cc1ccc2sc(COC(=O)c3cc(-c4ccco4)n[nH]3)nc2c1 |
| InChI | InChI=1S/C17H13N3O3S/c1-10-4-5-15-12(7-10)18-16(24-15)9-23-17(21)13-8-11(19-20-13)14-3-2-6-22-14/h2-8H,9H2,1H3,(H,19,20) |
| InChIKey | CVSKCVIPQOREIH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5-methyl-1,3-benzothiazol-2-yl)methyl 3-(furan-2-yl)-1H-pyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-1,3-benzothiazol-2-yl)methyl 3-(furan-2-yl)-1H-pyrazole-5-carboxylate?
The IUPAC name of (5-methyl-1,3-benzothiazol-2-yl)methyl 3-(furan-2-yl)-1H-pyrazole-5-carboxylate (CID 166366546) is (5-methyl-1,3-benzothiazol-2-yl)methyl 3-(furan-2-yl)-1H-pyrazole-5-carboxylate.
What is the SMILES notation for (5-methyl-1,3-benzothiazol-2-yl)methyl 3-(furan-2-yl)-1H-pyrazole-5-carboxylate?
The canonical SMILES for (5-methyl-1,3-benzothiazol-2-yl)methyl 3-(furan-2-yl)-1H-pyrazole-5-carboxylate is Cc1ccc2sc(COC(=O)c3cc(-c4ccco4)n[nH]3)nc2c1.
What is the InChIKey of (5-methyl-1,3-benzothiazol-2-yl)methyl 3-(furan-2-yl)-1H-pyrazole-5-carboxylate?
The InChIKey is CVSKCVIPQOREIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3O3S/c1-10-4-5-15-12(7-10)18-16(24-15)9-23-17(21)13-8-11(19-20-13)14-3-2-6-22-14/h2-8H,9H2,1H3,(H,19,20).
What are the key properties of (5-methyl-1,3-benzothiazol-2-yl)methyl 3-(furan-2-yl)-1H-pyrazole-5-carboxylate?
(5-methyl-1,3-benzothiazol-2-yl)methyl 3-(furan-2-yl)-1H-pyrazole-5-carboxylate has a molecular weight of 339.38 g/mol, XLogP of 3.94, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1,3-benzothiazol-2-yl)methyl 3-(furan-2-yl)-1H-pyrazole-5-carboxylate is sourced from PubChem (CID 166366546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).