C16H22BrN3 — CID 166367008
N-[1-(4-bromophenyl)ethyl]-6-methyl-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine (PubChem CID 166367008) has the molecular formula C16H22BrN3 and a molecular weight of 336.28 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)ethyl]-6-methyl-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine.
| Compound Name | N-[1-(4-bromophenyl)ethyl]-6-methyl-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine |
|---|---|
| PubChem CID | 166367008 |
| Molecular Formula | C16H22BrN3 |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | N-[1-(4-bromophenyl)ethyl]-6-methyl-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine |
| SMILES | CC1CCC2CN=C(NC(C)c3ccc(Br)cc3)N2C1 |
| InChI | InChI=1S/C16H22BrN3/c1-11-3-8-15-9-18-16(20(15)10-11)19-12(2)13-4-6-14(17)7-5-13/h4-7,11-12,15H,3,8-10H2,1-2H3,(H,18,19) |
| InChIKey | AFHNGAKCZKEJJE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |