C19H17BrFNO3 — CID 166367254
N-[4-(3-bromo-4-fluorophenoxy)phenyl]-7-oxabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 166367254) has the molecular formula C19H17BrFNO3 and a molecular weight of 406.25 g/mol. Its IUPAC name is N-[4-(3-bromo-4-fluorophenoxy)phenyl]-7-oxabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | N-[4-(3-bromo-4-fluorophenoxy)phenyl]-7-oxabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 166367254 |
| Molecular Formula | C19H17BrFNO3 |
| Molecular Weight | 406.25 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | N-[4-(3-bromo-4-fluorophenoxy)phenyl]-7-oxabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccc(F)c(Br)c2)cc1)C1CC2CCC1O2 |
| InChI | InChI=1S/C19H17BrFNO3/c20-16-10-14(5-7-17(16)21)24-12-3-1-11(2-4-12)22-19(23)15-9-13-6-8-18(15)25-13/h1-5,7,10,13,15,18H,6,8-9H2,(H,22,23) |
| InChIKey | KMCAYAINBUBCSY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.25 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |