C14H12N2O2S — CID 166368365
(4-isoquinolin-4-yl-3-methoxy-1,2-thiazol-5-yl)methanol (PubChem CID 166368365) has the molecular formula C14H12N2O2S and a molecular weight of 272.33 g/mol. Its IUPAC name is (4-isoquinolin-4-yl-3-methoxy-1,2-thiazol-5-yl)methanol.
| Compound Name | (4-isoquinolin-4-yl-3-methoxy-1,2-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 166368365 |
| Molecular Formula | C14H12N2O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | (4-isoquinolin-4-yl-3-methoxy-1,2-thiazol-5-yl)methanol |
| SMILES | COc1nsc(CO)c1-c1cncc2ccccc12 |
| InChI | InChI=1S/C14H12N2O2S/c1-18-14-13(12(8-17)19-16-14)11-7-15-6-9-4-2-3-5-10(9)11/h2-7,17H,8H2,1H3 |
| InChIKey | SVSWASOBCFJMQC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |