C13H8F4N4S — CID 166368391
2-[5-(2-fluoroethyl)-1-(3,4,5-trifluorophenyl)-1,2,4-triazol-3-yl]-1,3-thiazole (PubChem CID 166368391) has the molecular formula C13H8F4N4S and a molecular weight of 328.29 g/mol. Its IUPAC name is 2-[5-(2-fluoroethyl)-1-(3,4,5-trifluorophenyl)-1,2,4-triazol-3-yl]-1,3-thiazole.
| Compound Name | 2-[5-(2-fluoroethyl)-1-(3,4,5-trifluorophenyl)-1,2,4-triazol-3-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 166368391 |
| Molecular Formula | C13H8F4N4S |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-[5-(2-fluoroethyl)-1-(3,4,5-trifluorophenyl)-1,2,4-triazol-3-yl]-1,3-thiazole |
| SMILES | FCCc1nc(-c2nccs2)nn1-c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H8F4N4S/c14-2-1-10-19-12(13-18-3-4-22-13)20-21(10)7-5-8(15)11(17)9(16)6-7/h3-6H,1-2H2 |
| InChIKey | MZSLXLQHLUKTLS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|