C21H29NO4S — CID 166368742
2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl 3-(dimethylsulfamoyl)-4-methylbenzoate (PubChem CID 166368742) has the molecular formula C21H29NO4S and a molecular weight of 391.53 g/mol. Its IUPAC name is 2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl 3-(dimethylsulfamoyl)-4-methylbenzoate.
| Compound Name | 2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl 3-(dimethylsulfamoyl)-4-methylbenzoate |
|---|---|
| PubChem CID | 166368742 |
| Molecular Formula | C21H29NO4S |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl 3-(dimethylsulfamoyl)-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCCC2=CC[C@H]3C[C@@H]2C3(C)C)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C21H29NO4S/c1-14-6-7-16(12-19(14)27(24,25)22(4)5)20(23)26-11-10-15-8-9-17-13-18(15)21(17,2)3/h6-8,12,17-18H,9-11,13H2,1-5H3/t17-,18-/m0/s1 |
| InChIKey | KHLTZGUFUJUKNW-ROUUACIJSA-N |
| XLogP | 3.78 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|