C17H23NO3 — CID 166368747
2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl 2-(3-methyl-1,2-oxazol-4-yl)acetate (PubChem CID 166368747) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is 2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl 2-(3-methyl-1,2-oxazol-4-yl)acetate.
| Compound Name | 2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl 2-(3-methyl-1,2-oxazol-4-yl)acetate |
|---|---|
| PubChem CID | 166368747 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl 2-(3-methyl-1,2-oxazol-4-yl)acetate |
| SMILES | Cc1nocc1CC(=O)OCCC1=CC[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C17H23NO3/c1-11-13(10-21-18-11)8-16(19)20-7-6-12-4-5-14-9-15(12)17(14,2)3/h4,10,14-15H,5-9H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | DVQKZHGSQXIRKO-GJZGRUSLSA-N |
| XLogP | 3.45 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|