C23H22F3N3O5S2 — CID 16636900
8,8-dimethyl-4-(2-morpholin-4-yl-2-oxoethyl)-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 16636900) has the molecular formula C23H22F3N3O5S2 and a molecular weight of 541.57 g/mol. Its IUPAC name is 8,8-dimethyl-4-(2-morpholin-4-yl-2-oxoethyl)-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | 8,8-dimethyl-4-(2-morpholin-4-yl-2-oxoethyl)-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 16636900 |
| Molecular Formula | C23H22F3N3O5S2 |
| Molecular Weight | 541.57 g/mol |
| Exact Mass | 541.10 |
| IUPAC Name | 8,8-dimethyl-4-(2-morpholin-4-yl-2-oxoethyl)-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | CC1(C)c2sc(=O)n(CC(=O)N3CCOCC3)c2SC2C(=O)N(c3ccccc3C(F)(F)F)C(=O)C21 |
| InChI | InChI=1S/C23H22F3N3O5S2/c1-22(2)15-16(19(32)29(18(15)31)13-6-4-3-5-12(13)23(24,25)26)35-20-17(22)36-21(33)28(20)11-14(30)27-7-9-34-10-8-27/h3-6,15-16H,7-11H2,1-2H3 |
| InChIKey | FWPKSEWAUGALAW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 88.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.57 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|