C15H26N2O7 — CID 166369239
N-[(3S,3aR,6S,6aR)-3-[[(2R)-2-methoxypropanoyl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2,3-dimethoxypropanamide (PubChem CID 166369239) has the molecular formula C15H26N2O7 and a molecular weight of 346.38 g/mol. Its IUPAC name is N-[(3S,3aR,6S,6aR)-3-[[(2R)-2-methoxypropanoyl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2,3-dimethoxypropanamide.
| Compound Name | N-[(3S,3aR,6S,6aR)-3-[[(2R)-2-methoxypropanoyl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2,3-dimethoxypropanamide |
|---|---|
| PubChem CID | 166369239 |
| Molecular Formula | C15H26N2O7 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | N-[(3S,3aR,6S,6aR)-3-[[(2R)-2-methoxypropanoyl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2,3-dimethoxypropanamide |
| SMILES | COCC(OC)C(=O)N[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2NC(=O)[C@@H](C)OC |
| InChI | InChI=1S/C15H26N2O7/c1-8(21-3)14(18)16-9-5-23-13-10(6-24-12(9)13)17-15(19)11(22-4)7-20-2/h8-13H,5-7H2,1-4H3,(H,16,18)(H,17,19)/t8-,9+,10+,11?,12-,13-/m1/s1 |
| InChIKey | BDVILTSJQUBGAW-IHNHPCFUSA-N |
| XLogP | -1.55 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |