About N-benzyl-2-(2,7-diazaspiro[4.6]undecan-7-yl)quinazolin-4-amine
N-benzyl-2-(2,7-diazaspiro[4.6]undecan-7-yl)quinazolin-4-amine (PubChem CID 166369531) has the molecular formula C24H29N5
and a molecular weight of 387.53 g/mol. Its IUPAC name is N-benzyl-2-(2,7-diazaspiro[4.6]undecan-7-yl)quinazolin-4-amine.
Molecular Properties
| Compound Name | N-benzyl-2-(2,7-diazaspiro[4.6]undecan-7-yl)quinazolin-4-amine |
| PubChem CID | 166369531 |
| Molecular Formula | C24H29N5 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | N-benzyl-2-(2,7-diazaspiro[4.6]undecan-7-yl)quinazolin-4-amine |
| SMILES | c1ccc(CNc2nc(N3CCCCC4(CCNC4)C3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C24H29N5/c1-2-8-19(9-3-1)16-26-22-20-10-4-5-11-21(20)27-23(28-22)29-15-7-6-12-24(18-29)13-14-25-17-24/h1-5,8-11,25H,6-7,12-18H2,(H,26,27,28) |
| InChIKey | BTCZXJFCGQGPBE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-benzyl-2-(2,7-diazaspiro[4.6]undecan-7-yl)quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-(2,7-diazaspiro[4.6]undecan-7-yl)quinazolin-4-amine?
The IUPAC name of N-benzyl-2-(2,7-diazaspiro[4.6]undecan-7-yl)quinazolin-4-amine (CID 166369531) is N-benzyl-2-(2,7-diazaspiro[4.6]undecan-7-yl)quinazolin-4-amine.
What is the SMILES notation for N-benzyl-2-(2,7-diazaspiro[4.6]undecan-7-yl)quinazolin-4-amine?
The canonical SMILES for N-benzyl-2-(2,7-diazaspiro[4.6]undecan-7-yl)quinazolin-4-amine is c1ccc(CNc2nc(N3CCCCC4(CCNC4)C3)nc3ccccc23)cc1.
What is the InChIKey of N-benzyl-2-(2,7-diazaspiro[4.6]undecan-7-yl)quinazolin-4-amine?
The InChIKey is BTCZXJFCGQGPBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29N5/c1-2-8-19(9-3-1)16-26-22-20-10-4-5-11-21(20)27-23(28-22)29-15-7-6-12-24(18-29)13-14-25-17-24/h1-5,8-11,25H,6-7,12-18H2,(H,26,27,28).
What are the key properties of N-benzyl-2-(2,7-diazaspiro[4.6]undecan-7-yl)quinazolin-4-amine?
N-benzyl-2-(2,7-diazaspiro[4.6]undecan-7-yl)quinazolin-4-amine has a molecular weight of 387.53 g/mol, XLogP of 4.21, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-(2,7-diazaspiro[4.6]undecan-7-yl)quinazolin-4-amine is sourced from PubChem (CID 166369531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).