C22H24ClFN2O — CID 166369688
1-[[3-(4-chlorophenyl)cyclobutyl]methyl]-3-[3-(2-fluorophenyl)cyclobutyl]urea (PubChem CID 166369688) has the molecular formula C22H24ClFN2O and a molecular weight of 386.90 g/mol. Its IUPAC name is 1-[[3-(4-chlorophenyl)cyclobutyl]methyl]-3-[3-(2-fluorophenyl)cyclobutyl]urea.
| Compound Name | 1-[[3-(4-chlorophenyl)cyclobutyl]methyl]-3-[3-(2-fluorophenyl)cyclobutyl]urea |
|---|---|
| PubChem CID | 166369688 |
| Molecular Formula | C22H24ClFN2O |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 1-[[3-(4-chlorophenyl)cyclobutyl]methyl]-3-[3-(2-fluorophenyl)cyclobutyl]urea |
| SMILES | O=C(NCC1CC(c2ccc(Cl)cc2)C1)NC1CC(c2ccccc2F)C1 |
| InChI | InChI=1S/C22H24ClFN2O/c23-18-7-5-15(6-8-18)16-9-14(10-16)13-25-22(27)26-19-11-17(12-19)20-3-1-2-4-21(20)24/h1-8,14,16-17,19H,9-13H2,(H2,25,26,27) |
| InChIKey | RWJRLVIIKKKZPF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |