C21H23ClN2O — CID 166370560
N-[2-(2-chlorophenyl)ethyl]-1-(4-methylphenyl)-3-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 166370560) has the molecular formula C21H23ClN2O and a molecular weight of 354.88 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)ethyl]-1-(4-methylphenyl)-3-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | N-[2-(2-chlorophenyl)ethyl]-1-(4-methylphenyl)-3-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 166370560 |
| Molecular Formula | C21H23ClN2O |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N-[2-(2-chlorophenyl)ethyl]-1-(4-methylphenyl)-3-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | Cc1ccc(C23CC2CN(C(=O)NCCc2ccccc2Cl)C3)cc1 |
| InChI | InChI=1S/C21H23ClN2O/c1-15-6-8-17(9-7-15)21-12-18(21)13-24(14-21)20(25)23-11-10-16-4-2-3-5-19(16)22/h2-9,18H,10-14H2,1H3,(H,23,25) |
| InChIKey | YIVUSWZMPPWXQL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |