About 7-bromo-2-(2,2-difluoroethoxy)pyrido[1,2-a]pyrimidin-4-one
7-bromo-2-(2,2-difluoroethoxy)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 166370966) has the molecular formula C10H7BrF2N2O2
and a molecular weight of 305.08 g/mol. Its IUPAC name is 7-bromo-2-(2,2-difluoroethoxy)pyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 7-bromo-2-(2,2-difluoroethoxy)pyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 166370966 |
| Molecular Formula | C10H7BrF2N2O2 |
| Molecular Weight | 305.08 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | 7-bromo-2-(2,2-difluoroethoxy)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(OCC(F)F)nc2ccc(Br)cn12 |
| InChI | InChI=1S/C10H7BrF2N2O2/c11-6-1-2-8-14-9(17-5-7(12)13)3-10(16)15(8)4-6/h1-4,7H,5H2 |
| InChIKey | MSBQDTHTEXTXQJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.08 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-bromo-2-(2,2-difluoroethoxy)pyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-(2,2-difluoroethoxy)pyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 7-bromo-2-(2,2-difluoroethoxy)pyrido[1,2-a]pyrimidin-4-one (CID 166370966) is 7-bromo-2-(2,2-difluoroethoxy)pyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 7-bromo-2-(2,2-difluoroethoxy)pyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 7-bromo-2-(2,2-difluoroethoxy)pyrido[1,2-a]pyrimidin-4-one is O=c1cc(OCC(F)F)nc2ccc(Br)cn12.
What is the InChIKey of 7-bromo-2-(2,2-difluoroethoxy)pyrido[1,2-a]pyrimidin-4-one?
The InChIKey is MSBQDTHTEXTXQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrF2N2O2/c11-6-1-2-8-14-9(17-5-7(12)13)3-10(16)15(8)4-6/h1-4,7H,5H2.
What are the key properties of 7-bromo-2-(2,2-difluoroethoxy)pyrido[1,2-a]pyrimidin-4-one?
7-bromo-2-(2,2-difluoroethoxy)pyrido[1,2-a]pyrimidin-4-one has a molecular weight of 305.08 g/mol, XLogP of 2.10, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-(2,2-difluoroethoxy)pyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 166370966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).