(2R)-2-[(1,1-dioxothiolan-3-yl)amino]-3-methylbutanoic acid

C9H17NO4S — CID 16637229

IUPAC(2R)-2-[(1,1-dioxothiolan-3-yl)amino]-3-methylbutanoic acid
SMILESCC(C)[C@@H](NC1CCS(=O)(=O)C1)C(=O)O
InChIInChI=1S/C9H17NO4S/c1-6(2)8(9(11)12)10-7-3-4-15(13,14)5-7/h6-8,10H,3-5H2,1-2H3,(H,11,12)/t7?,8-/m1/s1
InChIKeyRBOIPJZEHYCNSP-BRFYHDHCSA-N
MW235.30 g/mol
LogP-0.13
Rot. Bonds4

About (2R)-2-[(1,1-dioxothiolan-3-yl)amino]-3-methylbutanoic acid

(2R)-2-[(1,1-dioxothiolan-3-yl)amino]-3-methylbutanoic acid (PubChem CID 16637229) has the molecular formula C9H17NO4S and a molecular weight of 235.30 g/mol. Its IUPAC name is (2R)-2-[(1,1-dioxothiolan-3-yl)amino]-3-methylbutanoic acid.

Molecular Properties

Compound Name(2R)-2-[(1,1-dioxothiolan-3-yl)amino]-3-methylbutanoic acid
PubChem CID16637229
Molecular FormulaC9H17NO4S
Molecular Weight235.30 g/mol
Exact Mass235.09
IUPAC Name(2R)-2-[(1,1-dioxothiolan-3-yl)amino]-3-methylbutanoic acid
SMILESCC(C)[C@@H](NC1CCS(=O)(=O)C1)C(=O)O
InChIInChI=1S/C9H17NO4S/c1-6(2)8(9(11)12)10-7-3-4-15(13,14)5-7/h6-8,10H,3-5H2,1-2H3,(H,11,12)/t7?,8-/m1/s1
InChIKeyRBOIPJZEHYCNSP-BRFYHDHCSA-N
XLogP-0.13
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.30
LogP ≤ 5-0.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze (2R)-2-[(1,1-dioxothiolan-3-yl)amino]-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-[(1,1-dioxothiolan-3-yl)amino]-3-methylbutanoic acid?
The IUPAC name of (2R)-2-[(1,1-dioxothiolan-3-yl)amino]-3-methylbutanoic acid (CID 16637229) is (2R)-2-[(1,1-dioxothiolan-3-yl)amino]-3-methylbutanoic acid.
What is the SMILES notation for (2R)-2-[(1,1-dioxothiolan-3-yl)amino]-3-methylbutanoic acid?
The canonical SMILES for (2R)-2-[(1,1-dioxothiolan-3-yl)amino]-3-methylbutanoic acid is CC(C)[C@@H](NC1CCS(=O)(=O)C1)C(=O)O.
What is the InChIKey of (2R)-2-[(1,1-dioxothiolan-3-yl)amino]-3-methylbutanoic acid?
The InChIKey is RBOIPJZEHYCNSP-BRFYHDHCSA-N. The full InChI is InChI=1S/C9H17NO4S/c1-6(2)8(9(11)12)10-7-3-4-15(13,14)5-7/h6-8,10H,3-5H2,1-2H3,(H,11,12)/t7?,8-/m1/s1.
What are the key properties of (2R)-2-[(1,1-dioxothiolan-3-yl)amino]-3-methylbutanoic acid?
(2R)-2-[(1,1-dioxothiolan-3-yl)amino]-3-methylbutanoic acid has a molecular weight of 235.30 g/mol, XLogP of -0.13, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(1,1-dioxothiolan-3-yl)amino]-3-methylbutanoic acid is sourced from PubChem (CID 16637229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).