C20H14N6O2 — CID 166372903
1-dibenzofuran-3-yl-3-(5-pyrazin-2-yl-1H-pyrazol-4-yl)urea (PubChem CID 166372903) has the molecular formula C20H14N6O2 and a molecular weight of 370.37 g/mol. Its IUPAC name is 1-dibenzofuran-3-yl-3-(5-pyrazin-2-yl-1H-pyrazol-4-yl)urea.
| Compound Name | 1-dibenzofuran-3-yl-3-(5-pyrazin-2-yl-1H-pyrazol-4-yl)urea |
|---|---|
| PubChem CID | 166372903 |
| Molecular Formula | C20H14N6O2 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 1-dibenzofuran-3-yl-3-(5-pyrazin-2-yl-1H-pyrazol-4-yl)urea |
| SMILES | O=C(Nc1ccc2c(c1)oc1ccccc12)Nc1cn[nH]c1-c1cnccn1 |
| InChI | InChI=1S/C20H14N6O2/c27-20(25-16-11-23-26-19(16)15-10-21-7-8-22-15)24-12-5-6-14-13-3-1-2-4-17(13)28-18(14)9-12/h1-11H,(H,23,26)(H2,24,25,27) |
| InChIKey | YJKPUDLMJVEBCQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |