C11H18N6O2 — CID 16637311
1,3-dimethyl-8-piperazin-1-yl-5,7-dihydro-4H-purine-2,6-dione (PubChem CID 16637311) has the molecular formula C11H18N6O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 1,3-dimethyl-8-piperazin-1-yl-5,7-dihydro-4H-purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-piperazin-1-yl-5,7-dihydro-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 16637311 |
| Molecular Formula | C11H18N6O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1,3-dimethyl-8-piperazin-1-yl-5,7-dihydro-4H-purine-2,6-dione |
| SMILES | CN1C(=O)C2NC(N3CCNCC3)=NC2N(C)C1=O |
| InChI | InChI=1S/C11H18N6O2/c1-15-8-7(9(18)16(2)11(15)19)13-10(14-8)17-5-3-12-4-6-17/h7-8,12H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | SMEIQGHUCPOYCH-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |