C9H6F5NO3S — CID 166373727
methyl 4-(2,2,3,3,3-pentafluoropropanoylamino)thiophene-2-carboxylate (PubChem CID 166373727) has the molecular formula C9H6F5NO3S and a molecular weight of 303.21 g/mol. Its IUPAC name is methyl 4-(2,2,3,3,3-pentafluoropropanoylamino)thiophene-2-carboxylate.
| Compound Name | methyl 4-(2,2,3,3,3-pentafluoropropanoylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 166373727 |
| Molecular Formula | C9H6F5NO3S |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | methyl 4-(2,2,3,3,3-pentafluoropropanoylamino)thiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)C(F)(F)C(F)(F)F)cs1 |
| InChI | InChI=1S/C9H6F5NO3S/c1-18-6(16)5-2-4(3-19-5)15-7(17)8(10,11)9(12,13)14/h2-3H,1H3,(H,15,17) |
| InChIKey | IYHQQQGGSZNXTB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|