About 1-[3-(5-methyl-2,1,3-benzoxadiazol-4-yl)phenyl]cyclobutan-1-ol
1-[3-(5-methyl-2,1,3-benzoxadiazol-4-yl)phenyl]cyclobutan-1-ol (PubChem CID 166374477) has the molecular formula C17H16N2O2
and a molecular weight of 280.33 g/mol. Its IUPAC name is 1-[3-(5-methyl-2,1,3-benzoxadiazol-4-yl)phenyl]cyclobutan-1-ol.
Molecular Properties
| Compound Name | 1-[3-(5-methyl-2,1,3-benzoxadiazol-4-yl)phenyl]cyclobutan-1-ol |
| PubChem CID | 166374477 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 1-[3-(5-methyl-2,1,3-benzoxadiazol-4-yl)phenyl]cyclobutan-1-ol |
| SMILES | Cc1ccc2nonc2c1-c1cccc(C2(O)CCC2)c1 |
| InChI | InChI=1S/C17H16N2O2/c1-11-6-7-14-16(19-21-18-14)15(11)12-4-2-5-13(10-12)17(20)8-3-9-17/h2,4-7,10,20H,3,8-9H2,1H3 |
| InChIKey | OFFMEZGQPZDHQB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-(5-methyl-2,1,3-benzoxadiazol-4-yl)phenyl]cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(5-methyl-2,1,3-benzoxadiazol-4-yl)phenyl]cyclobutan-1-ol?
The IUPAC name of 1-[3-(5-methyl-2,1,3-benzoxadiazol-4-yl)phenyl]cyclobutan-1-ol (CID 166374477) is 1-[3-(5-methyl-2,1,3-benzoxadiazol-4-yl)phenyl]cyclobutan-1-ol.
What is the SMILES notation for 1-[3-(5-methyl-2,1,3-benzoxadiazol-4-yl)phenyl]cyclobutan-1-ol?
The canonical SMILES for 1-[3-(5-methyl-2,1,3-benzoxadiazol-4-yl)phenyl]cyclobutan-1-ol is Cc1ccc2nonc2c1-c1cccc(C2(O)CCC2)c1.
What is the InChIKey of 1-[3-(5-methyl-2,1,3-benzoxadiazol-4-yl)phenyl]cyclobutan-1-ol?
The InChIKey is OFFMEZGQPZDHQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O2/c1-11-6-7-14-16(19-21-18-14)15(11)12-4-2-5-13(10-12)17(20)8-3-9-17/h2,4-7,10,20H,3,8-9H2,1H3.
What are the key properties of 1-[3-(5-methyl-2,1,3-benzoxadiazol-4-yl)phenyl]cyclobutan-1-ol?
1-[3-(5-methyl-2,1,3-benzoxadiazol-4-yl)phenyl]cyclobutan-1-ol has a molecular weight of 280.33 g/mol, XLogP of 3.57, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(5-methyl-2,1,3-benzoxadiazol-4-yl)phenyl]cyclobutan-1-ol is sourced from PubChem (CID 166374477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).