C21H28N4O5 — CID 166375312
N-[(3R,6R)-1-[(1R,2S)-2-cyclopropylcyclopropanecarbonyl]-6-methylpiperidin-3-yl]-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide (PubChem CID 166375312) has the molecular formula C21H28N4O5 and a molecular weight of 416.48 g/mol. Its IUPAC name is N-[(3R,6R)-1-[(1R,2S)-2-cyclopropylcyclopropanecarbonyl]-6-methylpiperidin-3-yl]-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide.
| Compound Name | N-[(3R,6R)-1-[(1R,2S)-2-cyclopropylcyclopropanecarbonyl]-6-methylpiperidin-3-yl]-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 166375312 |
| Molecular Formula | C21H28N4O5 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | N-[(3R,6R)-1-[(1R,2S)-2-cyclopropylcyclopropanecarbonyl]-6-methylpiperidin-3-yl]-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide |
| SMILES | C=CCN1C(=O)C(=O)N(CC(=O)N[C@@H]2CC[C@@H](C)N(C(=O)[C@@H]3C[C@H]3C3CC3)C2)C1=O |
| InChI | InChI=1S/C21H28N4O5/c1-3-8-23-19(28)20(29)25(21(23)30)11-17(26)22-14-7-4-12(2)24(10-14)18(27)16-9-15(16)13-5-6-13/h3,12-16H,1,4-11H2,2H3,(H,22,26)/t12-,14-,15+,16-/m1/s1 |
| InChIKey | LVDLCWHDJGZPES-DMRZNYOFSA-N |
| XLogP | 0.50 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|