C29H32N6O3S2 — CID 166375497
2-oxo-2-[4-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl]piperazin-1-yl]-N-[4-(2-phenylpropan-2-yl)-1,3-thiazol-2-yl]acetamide (PubChem CID 166375497) has the molecular formula C29H32N6O3S2 and a molecular weight of 576.75 g/mol. Its IUPAC name is 2-oxo-2-[4-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl]piperazin-1-yl]-N-[4-(2-phenylpropan-2-yl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-oxo-2-[4-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl]piperazin-1-yl]-N-[4-(2-phenylpropan-2-yl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 166375497 |
| Molecular Formula | C29H32N6O3S2 |
| Molecular Weight | 576.75 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | 2-oxo-2-[4-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl]piperazin-1-yl]-N-[4-(2-phenylpropan-2-yl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(C)(c1ccccc1)c1csc(NC(=O)C(=O)N2CCN(Cc3nc4sc5c(c4c(=O)[nH]3)CCCC5)CC2)n1 |
| InChI | InChI=1S/C29H32N6O3S2/c1-29(2,18-8-4-3-5-9-18)21-17-39-28(30-21)33-25(37)27(38)35-14-12-34(13-15-35)16-22-31-24(36)23-19-10-6-7-11-20(19)40-26(23)32-22/h3-5,8-9,17H,6-7,10-16H2,1-2H3,(H,30,33,37)(H,31,32,36) |
| InChIKey | NFYYIQAJKVKQNB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.75 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|