C15H21N3O4 — CID 166375735
1-[[(1S,2R,4S,5R,6S)-5,6-dihydroxy-2-bicyclo[2.2.1]heptanyl]methyl]-3-(1-methyl-2-oxo-3-pyridinyl)urea (PubChem CID 166375735) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is 1-[[(1S,2R,4S,5R,6S)-5,6-dihydroxy-2-bicyclo[2.2.1]heptanyl]methyl]-3-(1-methyl-2-oxo-3-pyridinyl)urea.
| Compound Name | 1-[[(1S,2R,4S,5R,6S)-5,6-dihydroxy-2-bicyclo[2.2.1]heptanyl]methyl]-3-(1-methyl-2-oxo-3-pyridinyl)urea |
|---|---|
| PubChem CID | 166375735 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 1-[[(1S,2R,4S,5R,6S)-5,6-dihydroxy-2-bicyclo[2.2.1]heptanyl]methyl]-3-(1-methyl-2-oxo-3-pyridinyl)urea |
| SMILES | Cn1cccc(NC(=O)NC[C@@H]2C[C@H]3C[C@@H]2[C@H](O)[C@@H]3O)c1=O |
| InChI | InChI=1S/C15H21N3O4/c1-18-4-2-3-11(14(18)21)17-15(22)16-7-9-5-8-6-10(9)13(20)12(8)19/h2-4,8-10,12-13,19-20H,5-7H2,1H3,(H2,16,17,22)/t8-,9-,10-,12+,13-/m0/s1 |
| InChIKey | KRADMPNUVAYUFP-STXZSOOUSA-N |
| XLogP | -0.12 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |