About 4-(1,3-dihydroisoindol-2-yl)-N-[2-[6-(dimethylamino)-3-pyridinyl]ethyl]pyrimidin-2-amine
4-(1,3-dihydroisoindol-2-yl)-N-[2-[6-(dimethylamino)-3-pyridinyl]ethyl]pyrimidin-2-amine (PubChem CID 166376089) has the molecular formula C21H24N6
and a molecular weight of 360.47 g/mol. Its IUPAC name is 4-(1,3-dihydroisoindol-2-yl)-N-[2-[6-(dimethylamino)-3-pyridinyl]ethyl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(1,3-dihydroisoindol-2-yl)-N-[2-[6-(dimethylamino)-3-pyridinyl]ethyl]pyrimidin-2-amine |
| PubChem CID | 166376089 |
| Molecular Formula | C21H24N6 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 4-(1,3-dihydroisoindol-2-yl)-N-[2-[6-(dimethylamino)-3-pyridinyl]ethyl]pyrimidin-2-amine |
| SMILES | CN(C)c1ccc(CCNc2nccc(N3Cc4ccccc4C3)n2)cn1 |
| InChI | InChI=1S/C21H24N6/c1-26(2)19-8-7-16(13-24-19)9-11-22-21-23-12-10-20(25-21)27-14-17-5-3-4-6-18(17)15-27/h3-8,10,12-13H,9,11,14-15H2,1-2H3,(H,22,23,25) |
| InChIKey | BGOCGMNJNWGJIE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(1,3-dihydroisoindol-2-yl)-N-[2-[6-(dimethylamino)-3-pyridinyl]ethyl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dihydroisoindol-2-yl)-N-[2-[6-(dimethylamino)-3-pyridinyl]ethyl]pyrimidin-2-amine?
The IUPAC name of 4-(1,3-dihydroisoindol-2-yl)-N-[2-[6-(dimethylamino)-3-pyridinyl]ethyl]pyrimidin-2-amine (CID 166376089) is 4-(1,3-dihydroisoindol-2-yl)-N-[2-[6-(dimethylamino)-3-pyridinyl]ethyl]pyrimidin-2-amine.
What is the SMILES notation for 4-(1,3-dihydroisoindol-2-yl)-N-[2-[6-(dimethylamino)-3-pyridinyl]ethyl]pyrimidin-2-amine?
The canonical SMILES for 4-(1,3-dihydroisoindol-2-yl)-N-[2-[6-(dimethylamino)-3-pyridinyl]ethyl]pyrimidin-2-amine is CN(C)c1ccc(CCNc2nccc(N3Cc4ccccc4C3)n2)cn1.
What is the InChIKey of 4-(1,3-dihydroisoindol-2-yl)-N-[2-[6-(dimethylamino)-3-pyridinyl]ethyl]pyrimidin-2-amine?
The InChIKey is BGOCGMNJNWGJIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N6/c1-26(2)19-8-7-16(13-24-19)9-11-22-21-23-12-10-20(25-21)27-14-17-5-3-4-6-18(17)15-27/h3-8,10,12-13H,9,11,14-15H2,1-2H3,(H,22,23,25).
What are the key properties of 4-(1,3-dihydroisoindol-2-yl)-N-[2-[6-(dimethylamino)-3-pyridinyl]ethyl]pyrimidin-2-amine?
4-(1,3-dihydroisoindol-2-yl)-N-[2-[6-(dimethylamino)-3-pyridinyl]ethyl]pyrimidin-2-amine has a molecular weight of 360.47 g/mol, XLogP of 3.11, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dihydroisoindol-2-yl)-N-[2-[6-(dimethylamino)-3-pyridinyl]ethyl]pyrimidin-2-amine is sourced from PubChem (CID 166376089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).