About 2-(4-cyanophenyl)ethyl 2-(phenoxymethyl)-1,3-thiazole-4-carboxylate
2-(4-cyanophenyl)ethyl 2-(phenoxymethyl)-1,3-thiazole-4-carboxylate (PubChem CID 166376534) has the molecular formula C20H16N2O3S
and a molecular weight of 364.43 g/mol. Its IUPAC name is 2-(4-cyanophenyl)ethyl 2-(phenoxymethyl)-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | 2-(4-cyanophenyl)ethyl 2-(phenoxymethyl)-1,3-thiazole-4-carboxylate |
| PubChem CID | 166376534 |
| Molecular Formula | C20H16N2O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 2-(4-cyanophenyl)ethyl 2-(phenoxymethyl)-1,3-thiazole-4-carboxylate |
| SMILES | N#Cc1ccc(CCOC(=O)c2csc(COc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H16N2O3S/c21-12-16-8-6-15(7-9-16)10-11-24-20(23)18-14-26-19(22-18)13-25-17-4-2-1-3-5-17/h1-9,14H,10-11,13H2 |
| InChIKey | OTZKDYHGWDLCIR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-cyanophenyl)ethyl 2-(phenoxymethyl)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-cyanophenyl)ethyl 2-(phenoxymethyl)-1,3-thiazole-4-carboxylate?
The IUPAC name of 2-(4-cyanophenyl)ethyl 2-(phenoxymethyl)-1,3-thiazole-4-carboxylate (CID 166376534) is 2-(4-cyanophenyl)ethyl 2-(phenoxymethyl)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for 2-(4-cyanophenyl)ethyl 2-(phenoxymethyl)-1,3-thiazole-4-carboxylate?
The canonical SMILES for 2-(4-cyanophenyl)ethyl 2-(phenoxymethyl)-1,3-thiazole-4-carboxylate is N#Cc1ccc(CCOC(=O)c2csc(COc3ccccc3)n2)cc1.
What is the InChIKey of 2-(4-cyanophenyl)ethyl 2-(phenoxymethyl)-1,3-thiazole-4-carboxylate?
The InChIKey is OTZKDYHGWDLCIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2O3S/c21-12-16-8-6-15(7-9-16)10-11-24-20(23)18-14-26-19(22-18)13-25-17-4-2-1-3-5-17/h1-9,14H,10-11,13H2.
What are the key properties of 2-(4-cyanophenyl)ethyl 2-(phenoxymethyl)-1,3-thiazole-4-carboxylate?
2-(4-cyanophenyl)ethyl 2-(phenoxymethyl)-1,3-thiazole-4-carboxylate has a molecular weight of 364.43 g/mol, XLogP of 3.99, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-cyanophenyl)ethyl 2-(phenoxymethyl)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 166376534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).