C19H23N5O7 — CID 16637792
3-(1,1-dimethylpiperidin-1-ium-2-yl)pyridine;3-methyl-2,4,6-trinitrophenolate (PubChem CID 16637792) has the molecular formula C19H23N5O7 and a molecular weight of 433.42 g/mol. Its IUPAC name is 3-(1,1-dimethylpiperidin-1-ium-2-yl)pyridine;3-methyl-2,4,6-trinitrophenolate.
| Compound Name | 3-(1,1-dimethylpiperidin-1-ium-2-yl)pyridine;3-methyl-2,4,6-trinitrophenolate |
|---|---|
| PubChem CID | 16637792 |
| Molecular Formula | C19H23N5O7 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 3-(1,1-dimethylpiperidin-1-ium-2-yl)pyridine;3-methyl-2,4,6-trinitrophenolate |
| SMILES | C[N+]1(C)CCCCC1c1cccnc1.Cc1c([N+](=O)[O-])cc([N+](=O)[O-])c([O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H19N2.C7H5N3O7/c1-14(2)9-4-3-7-12(14)11-6-5-8-13-10-11;1-3-4(8(12)13)2-5(9(14)15)7(11)6(3)10(16)17/h5-6,8,10,12H,3-4,7,9H2,1-2H3;2,11H,1H3/q+1;/p-1 |
| InChIKey | UKZGQBDKSSEPOX-UHFFFAOYSA-M |
| XLogP | 3.18 |
| TPSA | 165.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|