About methyl 5-[(5H-pyrrolo[2,3-b]pyrazine-2-carbonylamino)methyl]oxolane-3-carboxylate
methyl 5-[(5H-pyrrolo[2,3-b]pyrazine-2-carbonylamino)methyl]oxolane-3-carboxylate (PubChem CID 166379028) has the molecular formula C14H16N4O4
and a molecular weight of 304.31 g/mol. Its IUPAC name is methyl 5-[(5H-pyrrolo[2,3-b]pyrazine-2-carbonylamino)methyl]oxolane-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[(5H-pyrrolo[2,3-b]pyrazine-2-carbonylamino)methyl]oxolane-3-carboxylate |
| PubChem CID | 166379028 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | methyl 5-[(5H-pyrrolo[2,3-b]pyrazine-2-carbonylamino)methyl]oxolane-3-carboxylate |
| SMILES | COC(=O)C1COC(CNC(=O)c2cnc3[nH]ccc3n2)C1 |
| InChI | InChI=1S/C14H16N4O4/c1-21-14(20)8-4-9(22-7-8)5-17-13(19)11-6-16-12-10(18-11)2-3-15-12/h2-3,6,8-9H,4-5,7H2,1H3,(H,15,16)(H,17,19) |
| InChIKey | QXXVXMXZDCGLRC-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-[(5H-pyrrolo[2,3-b]pyrazine-2-carbonylamino)methyl]oxolane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(5H-pyrrolo[2,3-b]pyrazine-2-carbonylamino)methyl]oxolane-3-carboxylate?
The IUPAC name of methyl 5-[(5H-pyrrolo[2,3-b]pyrazine-2-carbonylamino)methyl]oxolane-3-carboxylate (CID 166379028) is methyl 5-[(5H-pyrrolo[2,3-b]pyrazine-2-carbonylamino)methyl]oxolane-3-carboxylate.
What is the SMILES notation for methyl 5-[(5H-pyrrolo[2,3-b]pyrazine-2-carbonylamino)methyl]oxolane-3-carboxylate?
The canonical SMILES for methyl 5-[(5H-pyrrolo[2,3-b]pyrazine-2-carbonylamino)methyl]oxolane-3-carboxylate is COC(=O)C1COC(CNC(=O)c2cnc3[nH]ccc3n2)C1.
What is the InChIKey of methyl 5-[(5H-pyrrolo[2,3-b]pyrazine-2-carbonylamino)methyl]oxolane-3-carboxylate?
The InChIKey is QXXVXMXZDCGLRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O4/c1-21-14(20)8-4-9(22-7-8)5-17-13(19)11-6-16-12-10(18-11)2-3-15-12/h2-3,6,8-9H,4-5,7H2,1H3,(H,15,16)(H,17,19).
What are the key properties of methyl 5-[(5H-pyrrolo[2,3-b]pyrazine-2-carbonylamino)methyl]oxolane-3-carboxylate?
methyl 5-[(5H-pyrrolo[2,3-b]pyrazine-2-carbonylamino)methyl]oxolane-3-carboxylate has a molecular weight of 304.31 g/mol, XLogP of 0.27, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(5H-pyrrolo[2,3-b]pyrazine-2-carbonylamino)methyl]oxolane-3-carboxylate is sourced from PubChem (CID 166379028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).