C17H20INO2 — CID 16637935
6-(6-iodohexanoyl)-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-11-one (PubChem CID 16637935) has the molecular formula C17H20INO2 and a molecular weight of 397.26 g/mol. Its IUPAC name is 6-(6-iodohexanoyl)-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-11-one.
| Compound Name | 6-(6-iodohexanoyl)-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-11-one |
|---|---|
| PubChem CID | 16637935 |
| Molecular Formula | C17H20INO2 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 6-(6-iodohexanoyl)-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-11-one |
| SMILES | O=C(CCCCCI)c1cc2c3c(c1)CCN3C(=O)CC2 |
| InChI | InChI=1S/C17H20INO2/c18-8-3-1-2-4-15(20)14-10-12-5-6-16(21)19-9-7-13(11-14)17(12)19/h10-11H,1-9H2 |
| InChIKey | VDDPLAAGGXPPLQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|