About (2-carbamoylphenyl) 2-(4-bromophenyl)-1,3-thiazole-5-sulfonate
(2-carbamoylphenyl) 2-(4-bromophenyl)-1,3-thiazole-5-sulfonate (PubChem CID 166380150) has the molecular formula C16H11BrN2O4S2
and a molecular weight of 439.31 g/mol. Its IUPAC name is (2-carbamoylphenyl) 2-(4-bromophenyl)-1,3-thiazole-5-sulfonate.
Molecular Properties
| Compound Name | (2-carbamoylphenyl) 2-(4-bromophenyl)-1,3-thiazole-5-sulfonate |
| PubChem CID | 166380150 |
| Molecular Formula | C16H11BrN2O4S2 |
| Molecular Weight | 439.31 g/mol |
| Exact Mass | 437.93 |
| IUPAC Name | (2-carbamoylphenyl) 2-(4-bromophenyl)-1,3-thiazole-5-sulfonate |
| SMILES | NC(=O)c1ccccc1OS(=O)(=O)c1cnc(-c2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C16H11BrN2O4S2/c17-11-7-5-10(6-8-11)16-19-9-14(24-16)25(21,22)23-13-4-2-1-3-12(13)15(18)20/h1-9H,(H2,18,20) |
| InChIKey | RYZVKDLDMBIZOF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-carbamoylphenyl) 2-(4-bromophenyl)-1,3-thiazole-5-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-carbamoylphenyl) 2-(4-bromophenyl)-1,3-thiazole-5-sulfonate?
The IUPAC name of (2-carbamoylphenyl) 2-(4-bromophenyl)-1,3-thiazole-5-sulfonate (CID 166380150) is (2-carbamoylphenyl) 2-(4-bromophenyl)-1,3-thiazole-5-sulfonate.
What is the SMILES notation for (2-carbamoylphenyl) 2-(4-bromophenyl)-1,3-thiazole-5-sulfonate?
The canonical SMILES for (2-carbamoylphenyl) 2-(4-bromophenyl)-1,3-thiazole-5-sulfonate is NC(=O)c1ccccc1OS(=O)(=O)c1cnc(-c2ccc(Br)cc2)s1.
What is the InChIKey of (2-carbamoylphenyl) 2-(4-bromophenyl)-1,3-thiazole-5-sulfonate?
The InChIKey is RYZVKDLDMBIZOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11BrN2O4S2/c17-11-7-5-10(6-8-11)16-19-9-14(24-16)25(21,22)23-13-4-2-1-3-12(13)15(18)20/h1-9H,(H2,18,20).
What are the key properties of (2-carbamoylphenyl) 2-(4-bromophenyl)-1,3-thiazole-5-sulfonate?
(2-carbamoylphenyl) 2-(4-bromophenyl)-1,3-thiazole-5-sulfonate has a molecular weight of 439.31 g/mol, XLogP of 3.44, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-carbamoylphenyl) 2-(4-bromophenyl)-1,3-thiazole-5-sulfonate is sourced from PubChem (CID 166380150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).