C17H18N2O2S — CID 166380312
3-[1-(4-ethenylphenyl)sulfonylpyrrolidin-3-yl]pyridine (PubChem CID 166380312) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is 3-[1-(4-ethenylphenyl)sulfonylpyrrolidin-3-yl]pyridine.
| Compound Name | 3-[1-(4-ethenylphenyl)sulfonylpyrrolidin-3-yl]pyridine |
|---|---|
| PubChem CID | 166380312 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 3-[1-(4-ethenylphenyl)sulfonylpyrrolidin-3-yl]pyridine |
| SMILES | C=Cc1ccc(S(=O)(=O)N2CCC(c3cccnc3)C2)cc1 |
| InChI | InChI=1S/C17H18N2O2S/c1-2-14-5-7-17(8-6-14)22(20,21)19-11-9-16(13-19)15-4-3-10-18-12-15/h2-8,10,12,16H,1,9,11,13H2 |
| InChIKey | NUJWNZQGYOZEOE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |