C18H24N4O4S — CID 166380691
1-[2-[4-(benzenesulfonamido)piperidin-1-yl]ethyl]-5-methylpyrazole-3-carboxylic acid (PubChem CID 166380691) has the molecular formula C18H24N4O4S and a molecular weight of 392.48 g/mol. Its IUPAC name is 1-[2-[4-(benzenesulfonamido)piperidin-1-yl]ethyl]-5-methylpyrazole-3-carboxylic acid.
| Compound Name | 1-[2-[4-(benzenesulfonamido)piperidin-1-yl]ethyl]-5-methylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 166380691 |
| Molecular Formula | C18H24N4O4S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1-[2-[4-(benzenesulfonamido)piperidin-1-yl]ethyl]-5-methylpyrazole-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)nn1CCN1CCC(NS(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H24N4O4S/c1-14-13-17(18(23)24)19-22(14)12-11-21-9-7-15(8-10-21)20-27(25,26)16-5-3-2-4-6-16/h2-6,13,15,20H,7-12H2,1H3,(H,23,24) |
| InChIKey | FNSBRZWLWICILK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |