C17H14F3N3O2 — CID 166381537
4-(6-methoxynaphthalen-2-yl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 166381537) has the molecular formula C17H14F3N3O2 and a molecular weight of 349.31 g/mol. Its IUPAC name is 4-(6-methoxynaphthalen-2-yl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 4-(6-methoxynaphthalen-2-yl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 166381537 |
| Molecular Formula | C17H14F3N3O2 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 4-(6-methoxynaphthalen-2-yl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | COc1ccc2cc(-c3c(C(F)(F)F)nn(C)c3C(N)=O)ccc2c1 |
| InChI | InChI=1S/C17H14F3N3O2/c1-23-14(16(21)24)13(15(22-23)17(18,19)20)11-4-3-10-8-12(25-2)6-5-9(10)7-11/h3-8H,1-2H3,(H2,21,24) |
| InChIKey | HHPNVZGXBZYIGE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |