C22H24BrN5O2 — CID 166381719
N-[3-[[(2-amino-4-bromobenzoyl)amino]methyl]-2,2-dimethylcyclobutyl]pyrazolo[1,5-a]pyridine-4-carboxamide (PubChem CID 166381719) has the molecular formula C22H24BrN5O2 and a molecular weight of 470.37 g/mol. Its IUPAC name is N-[3-[[(2-amino-4-bromobenzoyl)amino]methyl]-2,2-dimethylcyclobutyl]pyrazolo[1,5-a]pyridine-4-carboxamide.
| Compound Name | N-[3-[[(2-amino-4-bromobenzoyl)amino]methyl]-2,2-dimethylcyclobutyl]pyrazolo[1,5-a]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 166381719 |
| Molecular Formula | C22H24BrN5O2 |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | N-[3-[[(2-amino-4-bromobenzoyl)amino]methyl]-2,2-dimethylcyclobutyl]pyrazolo[1,5-a]pyridine-4-carboxamide |
| SMILES | CC1(C)C(CNC(=O)c2ccc(Br)cc2N)CC1NC(=O)c1cccn2nccc12 |
| InChI | InChI=1S/C22H24BrN5O2/c1-22(2)13(12-25-20(29)15-6-5-14(23)11-17(15)24)10-19(22)27-21(30)16-4-3-9-28-18(16)7-8-26-28/h3-9,11,13,19H,10,12,24H2,1-2H3,(H,25,29)(H,27,30) |
| InChIKey | XFEPDNXRFUNKIA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|