C19H24FN3 — CID 166382382
N-(4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-yl)-N'-(6-fluoro-2-pyridinyl)ethane-1,2-diamine (PubChem CID 166382382) has the molecular formula C19H24FN3 and a molecular weight of 313.42 g/mol. Its IUPAC name is N-(4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-yl)-N'-(6-fluoro-2-pyridinyl)ethane-1,2-diamine.
| Compound Name | N-(4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-yl)-N'-(6-fluoro-2-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 166382382 |
| Molecular Formula | C19H24FN3 |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | N-(4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-yl)-N'-(6-fluoro-2-pyridinyl)ethane-1,2-diamine |
| SMILES | CC1(C)CC(NCCNc2cccc(F)n2)Cc2ccccc21 |
| InChI | InChI=1S/C19H24FN3/c1-19(2)13-15(12-14-6-3-4-7-16(14)19)21-10-11-22-18-9-5-8-17(20)23-18/h3-9,15,21H,10-13H2,1-2H3,(H,22,23) |
| InChIKey | YZAXOZIKORFIEQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|