About methyl 3-[4-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethylamino)phenyl]-3-methylbutanoate
methyl 3-[4-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethylamino)phenyl]-3-methylbutanoate (PubChem CID 166384467) has the molecular formula C21H26N2O2
and a molecular weight of 338.45 g/mol. Its IUPAC name is methyl 3-[4-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethylamino)phenyl]-3-methylbutanoate.
Molecular Properties
| Compound Name | methyl 3-[4-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethylamino)phenyl]-3-methylbutanoate |
| PubChem CID | 166384467 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | methyl 3-[4-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethylamino)phenyl]-3-methylbutanoate |
| SMILES | COC(=O)CC(C)(C)c1ccc(NCc2ccc3c(n2)CCC3)cc1 |
| InChI | InChI=1S/C21H26N2O2/c1-21(2,13-20(24)25-3)16-8-11-17(12-9-16)22-14-18-10-7-15-5-4-6-19(15)23-18/h7-12,22H,4-6,13-14H2,1-3H3 |
| InChIKey | OPFQXOVWCVUOBT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-[4-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethylamino)phenyl]-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[4-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethylamino)phenyl]-3-methylbutanoate?
The IUPAC name of methyl 3-[4-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethylamino)phenyl]-3-methylbutanoate (CID 166384467) is methyl 3-[4-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethylamino)phenyl]-3-methylbutanoate.
What is the SMILES notation for methyl 3-[4-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethylamino)phenyl]-3-methylbutanoate?
The canonical SMILES for methyl 3-[4-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethylamino)phenyl]-3-methylbutanoate is COC(=O)CC(C)(C)c1ccc(NCc2ccc3c(n2)CCC3)cc1.
What is the InChIKey of methyl 3-[4-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethylamino)phenyl]-3-methylbutanoate?
The InChIKey is OPFQXOVWCVUOBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O2/c1-21(2,13-20(24)25-3)16-8-11-17(12-9-16)22-14-18-10-7-15-5-4-6-19(15)23-18/h7-12,22H,4-6,13-14H2,1-3H3.
What are the key properties of methyl 3-[4-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethylamino)phenyl]-3-methylbutanoate?
methyl 3-[4-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethylamino)phenyl]-3-methylbutanoate has a molecular weight of 338.45 g/mol, XLogP of 4.02, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[4-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethylamino)phenyl]-3-methylbutanoate is sourced from PubChem (CID 166384467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).