C15H15F4N3O — CID 166385837
N-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-3-(2-methylpyrazol-3-yl)propanamide (PubChem CID 166385837) has the molecular formula C15H15F4N3O and a molecular weight of 329.30 g/mol. Its IUPAC name is N-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-3-(2-methylpyrazol-3-yl)propanamide.
| Compound Name | N-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-3-(2-methylpyrazol-3-yl)propanamide |
|---|---|
| PubChem CID | 166385837 |
| Molecular Formula | C15H15F4N3O |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-3-(2-methylpyrazol-3-yl)propanamide |
| SMILES | Cn1nccc1CCC(=O)NCc1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C15H15F4N3O/c1-22-11(6-7-21-22)3-5-14(23)20-9-10-2-4-12(13(16)8-10)15(17,18)19/h2,4,6-8H,3,5,9H2,1H3,(H,20,23) |
| InChIKey | XTLLBLKSWZDVQR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |