C17H18N4O2S — CID 166386190
(3S)-3-hydroxy-N'-(2-methyl-6-phenylthieno[2,3-d]pyrimidin-4-yl)butanehydrazide (PubChem CID 166386190) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is (3S)-3-hydroxy-N'-(2-methyl-6-phenylthieno[2,3-d]pyrimidin-4-yl)butanehydrazide.
| Compound Name | (3S)-3-hydroxy-N'-(2-methyl-6-phenylthieno[2,3-d]pyrimidin-4-yl)butanehydrazide |
|---|---|
| PubChem CID | 166386190 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (3S)-3-hydroxy-N'-(2-methyl-6-phenylthieno[2,3-d]pyrimidin-4-yl)butanehydrazide |
| SMILES | Cc1nc(NNC(=O)C[C@H](C)O)c2cc(-c3ccccc3)sc2n1 |
| InChI | InChI=1S/C17H18N4O2S/c1-10(22)8-15(23)20-21-16-13-9-14(12-6-4-3-5-7-12)24-17(13)19-11(2)18-16/h3-7,9-10,22H,8H2,1-2H3,(H,20,23)(H,18,19,21)/t10-/m0/s1 |
| InChIKey | WLUJAFWXGDGFKM-JTQLQIEISA-N |
| XLogP | 2.88 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|