C16H15N5O — CID 166386338
(E)-1-(1,5-dimethylpyrazol-4-yl)-3-(2-phenyl-1,2,4-triazol-3-yl)prop-2-en-1-one (PubChem CID 166386338) has the molecular formula C16H15N5O and a molecular weight of 293.33 g/mol. Its IUPAC name is (E)-1-(1,5-dimethylpyrazol-4-yl)-3-(2-phenyl-1,2,4-triazol-3-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(1,5-dimethylpyrazol-4-yl)-3-(2-phenyl-1,2,4-triazol-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 166386338 |
| Molecular Formula | C16H15N5O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | (E)-1-(1,5-dimethylpyrazol-4-yl)-3-(2-phenyl-1,2,4-triazol-3-yl)prop-2-en-1-one |
| SMILES | Cc1c(C(=O)/C=C/c2ncnn2-c2ccccc2)cnn1C |
| InChI | InChI=1S/C16H15N5O/c1-12-14(10-18-20(12)2)15(22)8-9-16-17-11-19-21(16)13-6-4-3-5-7-13/h3-11H,1-2H3/b9-8+ |
| InChIKey | UOHCWPRBHIQMFM-CMDGGOBGSA-N |
| XLogP | 2.21 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|