C9H9F4N7O — CID 166386838
N-(3,3,4,4-tetrafluorobutan-2-yl)-5-(tetrazol-1-yl)-1H-pyrazole-4-carboxamide (PubChem CID 166386838) has the molecular formula C9H9F4N7O and a molecular weight of 307.21 g/mol. Its IUPAC name is N-(3,3,4,4-tetrafluorobutan-2-yl)-5-(tetrazol-1-yl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-(3,3,4,4-tetrafluorobutan-2-yl)-5-(tetrazol-1-yl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 166386838 |
| Molecular Formula | C9H9F4N7O |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-(3,3,4,4-tetrafluorobutan-2-yl)-5-(tetrazol-1-yl)-1H-pyrazole-4-carboxamide |
| SMILES | CC(NC(=O)c1cn[nH]c1-n1cnnn1)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H9F4N7O/c1-4(9(12,13)8(10)11)16-7(21)5-2-14-17-6(5)20-3-15-18-19-20/h2-4,8H,1H3,(H,14,17)(H,16,21) |
| InChIKey | YYSXNVDZMAURGL-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|