C16H20FNO2S — CID 166390372
N-[2-fluoro-2-(thian-4-ylidene)ethyl]-2-methoxy-5-methylbenzamide (PubChem CID 166390372) has the molecular formula C16H20FNO2S and a molecular weight of 309.41 g/mol. Its IUPAC name is N-[2-fluoro-2-(thian-4-ylidene)ethyl]-2-methoxy-5-methylbenzamide.
| Compound Name | N-[2-fluoro-2-(thian-4-ylidene)ethyl]-2-methoxy-5-methylbenzamide |
|---|---|
| PubChem CID | 166390372 |
| Molecular Formula | C16H20FNO2S |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | N-[2-fluoro-2-(thian-4-ylidene)ethyl]-2-methoxy-5-methylbenzamide |
| SMILES | COc1ccc(C)cc1C(=O)NCC(F)=C1CCSCC1 |
| InChI | InChI=1S/C16H20FNO2S/c1-11-3-4-15(20-2)13(9-11)16(19)18-10-14(17)12-5-7-21-8-6-12/h3-4,9H,5-8,10H2,1-2H3,(H,18,19) |
| InChIKey | SILGWMBJYZLAAG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |