C12H17ClFN3O — CID 166390434
4-amino-6-chloro-5-fluoro-N,N-dipropylpyridine-3-carboxamide (PubChem CID 166390434) has the molecular formula C12H17ClFN3O and a molecular weight of 273.74 g/mol. Its IUPAC name is 4-amino-6-chloro-5-fluoro-N,N-dipropylpyridine-3-carboxamide.
| Compound Name | 4-amino-6-chloro-5-fluoro-N,N-dipropylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 166390434 |
| Molecular Formula | C12H17ClFN3O |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 4-amino-6-chloro-5-fluoro-N,N-dipropylpyridine-3-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cnc(Cl)c(F)c1N |
| InChI | InChI=1S/C12H17ClFN3O/c1-3-5-17(6-4-2)12(18)8-7-16-11(13)9(14)10(8)15/h7H,3-6H2,1-2H3,(H2,15,16) |
| InChIKey | DFCLYAPFBHMFJM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|