About 3-[[1-(4-fluorophenyl)-4,6-dioxopyridazine-3-carbonyl]-methylamino]-2-methylpropanoic acid
3-[[1-(4-fluorophenyl)-4,6-dioxopyridazine-3-carbonyl]-methylamino]-2-methylpropanoic acid (PubChem CID 166390659) has the molecular formula C16H16FN3O5
and a molecular weight of 349.32 g/mol. Its IUPAC name is 3-[[1-(4-fluorophenyl)-4,6-dioxopyridazine-3-carbonyl]-methylamino]-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 3-[[1-(4-fluorophenyl)-4,6-dioxopyridazine-3-carbonyl]-methylamino]-2-methylpropanoic acid |
| PubChem CID | 166390659 |
| Molecular Formula | C16H16FN3O5 |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 3-[[1-(4-fluorophenyl)-4,6-dioxopyridazine-3-carbonyl]-methylamino]-2-methylpropanoic acid |
| SMILES | CC(CN(C)C(=O)C1=NN(c2ccc(F)cc2)C(=O)CC1=O)C(=O)O |
| InChI | InChI=1S/C16H16FN3O5/c1-9(16(24)25)8-19(2)15(23)14-12(21)7-13(22)20(18-14)11-5-3-10(17)4-6-11/h3-6,9H,7-8H2,1-2H3,(H,24,25) |
| InChIKey | HMPLMIQSMGJEAD-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-[[1-(4-fluorophenyl)-4,6-dioxopyridazine-3-carbonyl]-methylamino]-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[1-(4-fluorophenyl)-4,6-dioxopyridazine-3-carbonyl]-methylamino]-2-methylpropanoic acid?
The IUPAC name of 3-[[1-(4-fluorophenyl)-4,6-dioxopyridazine-3-carbonyl]-methylamino]-2-methylpropanoic acid (CID 166390659) is 3-[[1-(4-fluorophenyl)-4,6-dioxopyridazine-3-carbonyl]-methylamino]-2-methylpropanoic acid.
What is the SMILES notation for 3-[[1-(4-fluorophenyl)-4,6-dioxopyridazine-3-carbonyl]-methylamino]-2-methylpropanoic acid?
The canonical SMILES for 3-[[1-(4-fluorophenyl)-4,6-dioxopyridazine-3-carbonyl]-methylamino]-2-methylpropanoic acid is CC(CN(C)C(=O)C1=NN(c2ccc(F)cc2)C(=O)CC1=O)C(=O)O.
What is the InChIKey of 3-[[1-(4-fluorophenyl)-4,6-dioxopyridazine-3-carbonyl]-methylamino]-2-methylpropanoic acid?
The InChIKey is HMPLMIQSMGJEAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16FN3O5/c1-9(16(24)25)8-19(2)15(23)14-12(21)7-13(22)20(18-14)11-5-3-10(17)4-6-11/h3-6,9H,7-8H2,1-2H3,(H,24,25).
What are the key properties of 3-[[1-(4-fluorophenyl)-4,6-dioxopyridazine-3-carbonyl]-methylamino]-2-methylpropanoic acid?
3-[[1-(4-fluorophenyl)-4,6-dioxopyridazine-3-carbonyl]-methylamino]-2-methylpropanoic acid has a molecular weight of 349.32 g/mol, XLogP of 0.67, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[1-(4-fluorophenyl)-4,6-dioxopyridazine-3-carbonyl]-methylamino]-2-methylpropanoic acid is sourced from PubChem (CID 166390659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).