C13H19N2O3P — CID 166390735
1-(dimethylphosphorylmethyl)-N-(3-hydroxyphenyl)azetidine-3-carboxamide (PubChem CID 166390735) has the molecular formula C13H19N2O3P and a molecular weight of 282.28 g/mol. Its IUPAC name is 1-(dimethylphosphorylmethyl)-N-(3-hydroxyphenyl)azetidine-3-carboxamide.
| Compound Name | 1-(dimethylphosphorylmethyl)-N-(3-hydroxyphenyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 166390735 |
| Molecular Formula | C13H19N2O3P |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 1-(dimethylphosphorylmethyl)-N-(3-hydroxyphenyl)azetidine-3-carboxamide |
| SMILES | CP(C)(=O)CN1CC(C(=O)Nc2cccc(O)c2)C1 |
| InChI | InChI=1S/C13H19N2O3P/c1-19(2,18)9-15-7-10(8-15)13(17)14-11-4-3-5-12(16)6-11/h3-6,10,16H,7-9H2,1-2H3,(H,14,17) |
| InChIKey | DYUMWQADTDYOEB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|