C18H21N3O2 — CID 166390782
4-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-7-amino-2H-isoquinolin-1-one (PubChem CID 166390782) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is 4-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-7-amino-2H-isoquinolin-1-one.
| Compound Name | 4-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-7-amino-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 166390782 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 4-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-7-amino-2H-isoquinolin-1-one |
| SMILES | Nc1ccc2c(C(=O)N3C[C@H]4CCCC[C@H]4C3)c[nH]c(=O)c2c1 |
| InChI | InChI=1S/C18H21N3O2/c19-13-5-6-14-15(7-13)17(22)20-8-16(14)18(23)21-9-11-3-1-2-4-12(11)10-21/h5-8,11-12H,1-4,9-10,19H2,(H,20,22)/t11-,12+ |
| InChIKey | YVUFFJPLEBDGRZ-TXEJJXNPSA-N |
| XLogP | 2.37 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|