About 5-hydroxy-6,7-dihydro-5H-1-benzothiophen-4-one
5-hydroxy-6,7-dihydro-5H-1-benzothiophen-4-one (PubChem CID 16639090) has the molecular formula C8H8O2S
and a molecular weight of 168.22 g/mol. Its IUPAC name is 5-hydroxy-6,7-dihydro-5H-1-benzothiophen-4-one.
Molecular Properties
| Compound Name | 5-hydroxy-6,7-dihydro-5H-1-benzothiophen-4-one |
| PubChem CID | 16639090 |
| Molecular Formula | C8H8O2S |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | 5-hydroxy-6,7-dihydro-5H-1-benzothiophen-4-one |
| SMILES | O=C1c2ccsc2CCC1O |
| InChI | InChI=1S/C8H8O2S/c9-6-1-2-7-5(8(6)10)3-4-11-7/h3-4,6,9H,1-2H2 |
| InChIKey | HYTBINJOBAXXLJ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-hydroxy-6,7-dihydro-5H-1-benzothiophen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-6,7-dihydro-5H-1-benzothiophen-4-one?
The IUPAC name of 5-hydroxy-6,7-dihydro-5H-1-benzothiophen-4-one (CID 16639090) is 5-hydroxy-6,7-dihydro-5H-1-benzothiophen-4-one.
What is the SMILES notation for 5-hydroxy-6,7-dihydro-5H-1-benzothiophen-4-one?
The canonical SMILES for 5-hydroxy-6,7-dihydro-5H-1-benzothiophen-4-one is O=C1c2ccsc2CCC1O.
What is the InChIKey of 5-hydroxy-6,7-dihydro-5H-1-benzothiophen-4-one?
The InChIKey is HYTBINJOBAXXLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2S/c9-6-1-2-7-5(8(6)10)3-4-11-7/h3-4,6,9H,1-2H2.
What are the key properties of 5-hydroxy-6,7-dihydro-5H-1-benzothiophen-4-one?
5-hydroxy-6,7-dihydro-5H-1-benzothiophen-4-one has a molecular weight of 168.22 g/mol, XLogP of 1.24, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-6,7-dihydro-5H-1-benzothiophen-4-one is sourced from PubChem (CID 16639090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).