C17H24N2O5 — CID 166391197
benzyl N-[(3S)-3-hydroxy-4-[(3R)-3-hydroxypiperidin-1-yl]-4-oxobutyl]carbamate (PubChem CID 166391197) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is benzyl N-[(3S)-3-hydroxy-4-[(3R)-3-hydroxypiperidin-1-yl]-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[(3S)-3-hydroxy-4-[(3R)-3-hydroxypiperidin-1-yl]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 166391197 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | benzyl N-[(3S)-3-hydroxy-4-[(3R)-3-hydroxypiperidin-1-yl]-4-oxobutyl]carbamate |
| SMILES | O=C(NCC[C@H](O)C(=O)N1CCC[C@@H](O)C1)OCc1ccccc1 |
| InChI | InChI=1S/C17H24N2O5/c20-14-7-4-10-19(11-14)16(22)15(21)8-9-18-17(23)24-12-13-5-2-1-3-6-13/h1-3,5-6,14-15,20-21H,4,7-12H2,(H,18,23)/t14-,15+/m1/s1 |
| InChIKey | RIEFOQAZDMQPAL-CABCVRRESA-N |
| XLogP | 0.65 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |