C19H14ClF3N4O — CID 166392142
3-[[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methylamino]methyl]naphthalen-2-ol (PubChem CID 166392142) has the molecular formula C19H14ClF3N4O and a molecular weight of 406.80 g/mol. Its IUPAC name is 3-[[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methylamino]methyl]naphthalen-2-ol.
| Compound Name | 3-[[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methylamino]methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 166392142 |
| Molecular Formula | C19H14ClF3N4O |
| Molecular Weight | 406.80 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 3-[[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methylamino]methyl]naphthalen-2-ol |
| SMILES | Oc1cc2ccccc2cc1CNCc1nnc2c(Cl)cc(C(F)(F)F)cn12 |
| InChI | InChI=1S/C19H14ClF3N4O/c20-15-7-14(19(21,22)23)10-27-17(25-26-18(15)27)9-24-8-13-5-11-3-1-2-4-12(11)6-16(13)28/h1-7,10,24,28H,8-9H2 |
| InChIKey | QSMHIYMVYXNMAJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.80 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|