About 2-[3-(5-chlorothieno[3,2-b]pyridin-2-yl)pyrazol-1-yl]propanoic acid
2-[3-(5-chlorothieno[3,2-b]pyridin-2-yl)pyrazol-1-yl]propanoic acid (PubChem CID 166393102) has the molecular formula C13H10ClN3O2S
and a molecular weight of 307.76 g/mol. Its IUPAC name is 2-[3-(5-chlorothieno[3,2-b]pyridin-2-yl)pyrazol-1-yl]propanoic acid.
Molecular Properties
| Compound Name | 2-[3-(5-chlorothieno[3,2-b]pyridin-2-yl)pyrazol-1-yl]propanoic acid |
| PubChem CID | 166393102 |
| Molecular Formula | C13H10ClN3O2S |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 2-[3-(5-chlorothieno[3,2-b]pyridin-2-yl)pyrazol-1-yl]propanoic acid |
| SMILES | CC(C(=O)O)n1ccc(-c2cc3nc(Cl)ccc3s2)n1 |
| InChI | InChI=1S/C13H10ClN3O2S/c1-7(13(18)19)17-5-4-8(16-17)11-6-9-10(20-11)2-3-12(14)15-9/h2-7H,1H3,(H,18,19) |
| InChIKey | KNTXTICONVLIBP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(5-chlorothieno[3,2-b]pyridin-2-yl)pyrazol-1-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(5-chlorothieno[3,2-b]pyridin-2-yl)pyrazol-1-yl]propanoic acid?
The IUPAC name of 2-[3-(5-chlorothieno[3,2-b]pyridin-2-yl)pyrazol-1-yl]propanoic acid (CID 166393102) is 2-[3-(5-chlorothieno[3,2-b]pyridin-2-yl)pyrazol-1-yl]propanoic acid.
What is the SMILES notation for 2-[3-(5-chlorothieno[3,2-b]pyridin-2-yl)pyrazol-1-yl]propanoic acid?
The canonical SMILES for 2-[3-(5-chlorothieno[3,2-b]pyridin-2-yl)pyrazol-1-yl]propanoic acid is CC(C(=O)O)n1ccc(-c2cc3nc(Cl)ccc3s2)n1.
What is the InChIKey of 2-[3-(5-chlorothieno[3,2-b]pyridin-2-yl)pyrazol-1-yl]propanoic acid?
The InChIKey is KNTXTICONVLIBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClN3O2S/c1-7(13(18)19)17-5-4-8(16-17)11-6-9-10(20-11)2-3-12(14)15-9/h2-7H,1H3,(H,18,19).
What are the key properties of 2-[3-(5-chlorothieno[3,2-b]pyridin-2-yl)pyrazol-1-yl]propanoic acid?
2-[3-(5-chlorothieno[3,2-b]pyridin-2-yl)pyrazol-1-yl]propanoic acid has a molecular weight of 307.76 g/mol, XLogP of 3.46, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(5-chlorothieno[3,2-b]pyridin-2-yl)pyrazol-1-yl]propanoic acid is sourced from PubChem (CID 166393102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).