C16H22N4O6S — CID 166393120
N-(tert-butylsulfamoyl)-2-(6,7-dimethoxy-4-oxoquinazolin-3-yl)acetamide (PubChem CID 166393120) has the molecular formula C16H22N4O6S and a molecular weight of 398.44 g/mol. Its IUPAC name is N-(tert-butylsulfamoyl)-2-(6,7-dimethoxy-4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-(tert-butylsulfamoyl)-2-(6,7-dimethoxy-4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 166393120 |
| Molecular Formula | C16H22N4O6S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-(tert-butylsulfamoyl)-2-(6,7-dimethoxy-4-oxoquinazolin-3-yl)acetamide |
| SMILES | COc1cc2ncn(CC(=O)NS(=O)(=O)NC(C)(C)C)c(=O)c2cc1OC |
| InChI | InChI=1S/C16H22N4O6S/c1-16(2,3)19-27(23,24)18-14(21)8-20-9-17-11-7-13(26-5)12(25-4)6-10(11)15(20)22/h6-7,9,19H,8H2,1-5H3,(H,18,21) |
| InChIKey | QXCUFYLEBLHIPF-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |