About 2-[[1-(2,3-dihydro-1H-indol-6-yl)triazol-4-yl]methyl]propane-1,3-diol
2-[[1-(2,3-dihydro-1H-indol-6-yl)triazol-4-yl]methyl]propane-1,3-diol (PubChem CID 166393549) has the molecular formula C14H18N4O2
and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-[[1-(2,3-dihydro-1H-indol-6-yl)triazol-4-yl]methyl]propane-1,3-diol.
Molecular Properties
| Compound Name | 2-[[1-(2,3-dihydro-1H-indol-6-yl)triazol-4-yl]methyl]propane-1,3-diol |
| PubChem CID | 166393549 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-[[1-(2,3-dihydro-1H-indol-6-yl)triazol-4-yl]methyl]propane-1,3-diol |
| SMILES | OCC(CO)Cc1cn(-c2ccc3c(c2)NCC3)nn1 |
| InChI | InChI=1S/C14H18N4O2/c19-8-10(9-20)5-12-7-18(17-16-12)13-2-1-11-3-4-15-14(11)6-13/h1-2,6-7,10,15,19-20H,3-5,8-9H2 |
| InChIKey | ACZNDNZFDFZMGL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[1-(2,3-dihydro-1H-indol-6-yl)triazol-4-yl]methyl]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(2,3-dihydro-1H-indol-6-yl)triazol-4-yl]methyl]propane-1,3-diol?
The IUPAC name of 2-[[1-(2,3-dihydro-1H-indol-6-yl)triazol-4-yl]methyl]propane-1,3-diol (CID 166393549) is 2-[[1-(2,3-dihydro-1H-indol-6-yl)triazol-4-yl]methyl]propane-1,3-diol.
What is the SMILES notation for 2-[[1-(2,3-dihydro-1H-indol-6-yl)triazol-4-yl]methyl]propane-1,3-diol?
The canonical SMILES for 2-[[1-(2,3-dihydro-1H-indol-6-yl)triazol-4-yl]methyl]propane-1,3-diol is OCC(CO)Cc1cn(-c2ccc3c(c2)NCC3)nn1.
What is the InChIKey of 2-[[1-(2,3-dihydro-1H-indol-6-yl)triazol-4-yl]methyl]propane-1,3-diol?
The InChIKey is ACZNDNZFDFZMGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O2/c19-8-10(9-20)5-12-7-18(17-16-12)13-2-1-11-3-4-15-14(11)6-13/h1-2,6-7,10,15,19-20H,3-5,8-9H2.
What are the key properties of 2-[[1-(2,3-dihydro-1H-indol-6-yl)triazol-4-yl]methyl]propane-1,3-diol?
2-[[1-(2,3-dihydro-1H-indol-6-yl)triazol-4-yl]methyl]propane-1,3-diol has a molecular weight of 274.32 g/mol, XLogP of 0.38, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(2,3-dihydro-1H-indol-6-yl)triazol-4-yl]methyl]propane-1,3-diol is sourced from PubChem (CID 166393549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).